C18H17NO2 — CID 10945800
4-(1,3-benzodioxol-5-yl)-1-benzyl-2,3-dihydropyrrole (PubChem CID 10945800) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-1-benzyl-2,3-dihydropyrrole.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-1-benzyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 10945800 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-1-benzyl-2,3-dihydropyrrole |
| SMILES | C1=C(c2ccc3c(c2)OCO3)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c1-2-4-14(5-3-1)11-19-9-8-16(12-19)15-6-7-17-18(10-15)21-13-20-17/h1-7,10,12H,8-9,11,13H2 |
| InChIKey | GVXQKVSHEXVVST-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |