C9H20N2 — CID 134291651
(Z,3R)-2-N,3-dimethylhept-4-ene-1,2-diamine (PubChem CID 134291651) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is (Z,3R)-2-N,3-dimethylhept-4-ene-1,2-diamine.
| Compound Name | (Z,3R)-2-N,3-dimethylhept-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 134291651 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (Z,3R)-2-N,3-dimethylhept-4-ene-1,2-diamine |
| SMILES | CC/C=C\[C@@H](C)C(CN)NC |
| InChI | InChI=1S/C9H20N2/c1-4-5-6-8(2)9(7-10)11-3/h5-6,8-9,11H,4,7,10H2,1-3H3/b6-5-/t8-,9?/m1/s1 |
| InChIKey | HIXVHBSJNJMHTI-DVSVKTLJSA-N |
| XLogP | 1.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|