C25H36N2 — CID 134293562
(2E,4Z)-4-ethenyl-N-[(2E,4E)-6-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]hepta-2,4,6-trien-2-amine (PubChem CID 134293562) has the molecular formula C25H36N2 and a molecular weight of 364.58 g/mol. Its IUPAC name is (2E,4Z)-4-ethenyl-N-[(2E,4E)-6-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z)-4-ethenyl-N-[(2E,4E)-6-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 134293562 |
| Molecular Formula | C25H36N2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | (2E,4Z)-4-ethenyl-N-[(2E,4E)-6-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C(C=C)\C=C(/C)N/C(C)=C/C(=C\C(=C)C)C1(C(=C)C)CCNCC1 |
| InChI | InChI=1S/C25H36N2/c1-9-11-23(10-2)17-21(7)27-22(8)18-24(16-19(3)4)25(20(5)6)12-14-26-15-13-25/h9-11,16-18,26-27H,1-3,5,12-15H2,4,6-8H3/b21-17+,22-18+,23-11-,24-16+ |
| InChIKey | MRGPQOCKPNMIRX-KVRYZVPWSA-N |
| XLogP | 6.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|