C16H7F25O6 — CID 134295247
1-(1,1-difluoro-2-prop-2-enoxyethoxy)-4-[3-[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2,3,3,4,4-octafluorobutane (PubChem CID 134295247) has the molecular formula C16H7F25O6 and a molecular weight of 770.18 g/mol. Its IUPAC name is 1-(1,1-difluoro-2-prop-2-enoxyethoxy)-4-[3-[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2,3,3,4,4-octafluorobutane.
| Compound Name | 1-(1,1-difluoro-2-prop-2-enoxyethoxy)-4-[3-[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2,3,3,4,4-octafluorobutane |
|---|---|
| PubChem CID | 134295247 |
| Molecular Formula | C16H7F25O6 |
| Molecular Weight | 770.18 g/mol |
| Exact Mass | 769.98 |
| IUPAC Name | 1-(1,1-difluoro-2-prop-2-enoxyethoxy)-4-[3-[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2,3,3,4,4-octafluorobutane |
| SMILES | C=CCOCC(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C16H7F25O6/c1-2-3-42-4-5(17,18)43-9(25,26)6(19,20)7(21,22)10(27,28)44-11(29,30)8(23,24)12(31,32)45-13(33,34)14(35,36)46-16(40,41)47-15(37,38)39/h2H,1,3-4H2 |
| InChIKey | VSYHHKLSZMYCQM-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.18 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|