C10H8F10O4 — CID 59866553
3-[2-[[2-(2,2-difluoroethenoxy)-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]prop-1-ene (PubChem CID 59866553) has the molecular formula C10H8F10O4 and a molecular weight of 382.15 g/mol. Its IUPAC name is 3-[2-[[2-(2,2-difluoroethenoxy)-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]prop-1-ene.
| Compound Name | 3-[2-[[2-(2,2-difluoroethenoxy)-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]prop-1-ene |
|---|---|
| PubChem CID | 59866553 |
| Molecular Formula | C10H8F10O4 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 3-[2-[[2-(2,2-difluoroethenoxy)-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]prop-1-ene |
| SMILES | C=CCOCC(F)(F)OC(F)(F)OC(F)(F)C(F)(F)OC=C(F)F |
| InChI | InChI=1S/C10H8F10O4/c1-2-3-21-5-7(13,14)23-10(19,20)24-9(17,18)8(15,16)22-4-6(11)12/h2,4H,1,3,5H2 |
| InChIKey | YZRVWHNHPYVIMO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|