C13H20F4O5 — CID 158483688
3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]prop-1-ene (PubChem CID 158483688) has the molecular formula C13H20F4O5 and a molecular weight of 332.29 g/mol. Its IUPAC name is 3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]prop-1-ene.
| Compound Name | 3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 158483688 |
| Molecular Formula | C13H20F4O5 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]prop-1-ene |
| SMILES | C=CCOCCOCOCC(F)(F)OC(F)(F)COCC=C |
| InChI | InChI=1S/C13H20F4O5/c1-3-5-18-7-8-20-11-21-10-13(16,17)22-12(14,15)9-19-6-4-2/h3-4H,1-2,5-11H2 |
| InChIKey | HHVDEXYPFHXULR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|