C12H14F8O5 — CID 57259911
3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-[1-(1,1,2,2-tetrafluoro-2-methoxyethoxy)prop-2-enoxy]prop-1-ene (PubChem CID 57259911) has the molecular formula C12H14F8O5 and a molecular weight of 390.22 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-[1-(1,1,2,2-tetrafluoro-2-methoxyethoxy)prop-2-enoxy]prop-1-ene.
| Compound Name | 3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-[1-(1,1,2,2-tetrafluoro-2-methoxyethoxy)prop-2-enoxy]prop-1-ene |
|---|---|
| PubChem CID | 57259911 |
| Molecular Formula | C12H14F8O5 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-[1-(1,1,2,2-tetrafluoro-2-methoxyethoxy)prop-2-enoxy]prop-1-ene |
| SMILES | C=CC(OC(C=C)OC(F)(F)C(F)(F)OC)OC(F)(F)C(F)(F)OC |
| InChI | InChI=1S/C12H14F8O5/c1-5-7(24-11(17,18)9(13,14)21-3)23-8(6-2)25-12(19,20)10(15,16)22-4/h5-8H,1-2H2,3-4H3 |
| InChIKey | HVLQCYUKRWRYPX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|