C15H15F13O5 — CID 121401315
1-[3-(2-ethenoxy-2-ethoxyethoxy)-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 121401315) has the molecular formula C15H15F13O5 and a molecular weight of 522.25 g/mol. Its IUPAC name is 1-[3-(2-ethenoxy-2-ethoxyethoxy)-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1-[3-(2-ethenoxy-2-ethoxyethoxy)-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 121401315 |
| Molecular Formula | C15H15F13O5 |
| Molecular Weight | 522.25 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 1-[3-(2-ethenoxy-2-ethoxyethoxy)-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=COC(COCC(F)(OC(F)(F)C(F)(OC(F)(F)C(=C)F)C(F)(F)F)C(F)(F)F)OCC |
| InChI | InChI=1S/C15H15F13O5/c1-4-30-9(31-5-2)6-29-7-10(17,13(21,22)23)32-15(27,28)12(20,14(24,25)26)33-11(18,19)8(3)16/h4,9H,1,3,5-7H2,2H3 |
| InChIKey | SFGYMRQBNZSUKA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.25 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|