C10H11F9O4 — CID 102038621
3-[tris(2,2,2-trifluoroethoxy)methoxy]prop-1-ene (PubChem CID 102038621) has the molecular formula C10H11F9O4 and a molecular weight of 366.18 g/mol. Its IUPAC name is 3-[tris(2,2,2-trifluoroethoxy)methoxy]prop-1-ene.
| Compound Name | 3-[tris(2,2,2-trifluoroethoxy)methoxy]prop-1-ene |
|---|---|
| PubChem CID | 102038621 |
| Molecular Formula | C10H11F9O4 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 3-[tris(2,2,2-trifluoroethoxy)methoxy]prop-1-ene |
| SMILES | C=CCOC(OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C10H11F9O4/c1-2-3-20-10(21-4-7(11,12)13,22-5-8(14,15)16)23-6-9(17,18)19/h2H,1,3-6H2 |
| InChIKey | AEXSDTMSJPFYBT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|