C29H31NO7 — CID 134295825
[1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-oxopropyl] 2-acetyloxybenzoate (PubChem CID 134295825) has the molecular formula C29H31NO7 and a molecular weight of 505.57 g/mol. Its IUPAC name is [1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-oxopropyl] 2-acetyloxybenzoate.
| Compound Name | [1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-oxopropyl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 134295825 |
| Molecular Formula | C29H31NO7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | [1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-oxopropyl] 2-acetyloxybenzoate |
| SMILES | COc1cccc(CCc2ccccc2OC(=O)CC(OC(=O)c2ccccc2OC(C)=O)N(C)C)c1 |
| InChI | InChI=1S/C29H31NO7/c1-20(31)35-26-15-8-6-13-24(26)29(33)37-27(30(2)3)19-28(32)36-25-14-7-5-11-22(25)17-16-21-10-9-12-23(18-21)34-4/h5-15,18,27H,16-17,19H2,1-4H3 |
| InChIKey | ZPJQJIJVROGSHM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|