C23H28F3NO4 — CID 135372229
[(4S)-4-(dimethylamino)-4-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]butan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 135372229) has the molecular formula C23H28F3NO4 and a molecular weight of 439.47 g/mol. Its IUPAC name is [(4S)-4-(dimethylamino)-4-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]butan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(4S)-4-(dimethylamino)-4-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]butan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 135372229 |
| Molecular Formula | C23H28F3NO4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | [(4S)-4-(dimethylamino)-4-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]butan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1cccc(CCc2ccccc2O[C@@H](CC(C)OC(=O)C(F)(F)F)N(C)C)c1 |
| InChI | InChI=1S/C23H28F3NO4/c1-16(30-22(28)23(24,25)26)14-21(27(2)3)31-20-11-6-5-9-18(20)13-12-17-8-7-10-19(15-17)29-4/h5-11,15-16,21H,12-14H2,1-4H3/t16?,21-/m0/s1 |
| InChIKey | OCTBVCUGBXFKPD-MRNPHLECSA-N |
| XLogP | 4.63 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|