C22H30FNO3 — CID 175806278
1-[2-[2-[3-(fluoromethoxy)phenyl]ethyl]phenoxy]-3-methoxy-N,N-dimethylbutan-1-amine (PubChem CID 175806278) has the molecular formula C22H30FNO3 and a molecular weight of 375.48 g/mol. Its IUPAC name is 1-[2-[2-[3-(fluoromethoxy)phenyl]ethyl]phenoxy]-3-methoxy-N,N-dimethylbutan-1-amine.
| Compound Name | 1-[2-[2-[3-(fluoromethoxy)phenyl]ethyl]phenoxy]-3-methoxy-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 175806278 |
| Molecular Formula | C22H30FNO3 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-[2-[2-[3-(fluoromethoxy)phenyl]ethyl]phenoxy]-3-methoxy-N,N-dimethylbutan-1-amine |
| SMILES | COC(C)CC(Oc1ccccc1CCc1cccc(OCF)c1)N(C)C |
| InChI | InChI=1S/C22H30FNO3/c1-17(25-4)14-22(24(2)3)27-21-11-6-5-9-19(21)13-12-18-8-7-10-20(15-18)26-16-23/h5-11,15,17,22H,12-14,16H2,1-4H3 |
| InChIKey | DDFXSFGHWUAZEC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|