C21H23F6NO3 — CID 174994502
(2S)-4-[methyl(trifluoromethyl)amino]-1-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]butan-2-ol (PubChem CID 174994502) has the molecular formula C21H23F6NO3 and a molecular weight of 451.41 g/mol. Its IUPAC name is (2S)-4-[methyl(trifluoromethyl)amino]-1-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]butan-2-ol.
| Compound Name | (2S)-4-[methyl(trifluoromethyl)amino]-1-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 174994502 |
| Molecular Formula | C21H23F6NO3 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (2S)-4-[methyl(trifluoromethyl)amino]-1-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]butan-2-ol |
| SMILES | CN(CC[C@H](O)COc1ccccc1CCc1cccc(OC(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C21H23F6NO3/c1-28(20(22,23)24)12-11-17(29)14-30-19-8-3-2-6-16(19)10-9-15-5-4-7-18(13-15)31-21(25,26)27/h2-8,13,17,29H,9-12,14H2,1H3/t17-/m0/s1 |
| InChIKey | YWFIVIZBKIAGDC-KRWDZBQOSA-N |
| XLogP | 4.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|