C22H19F12NO3 — CID 175806112
1-(trifluoromethoxy)-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine (PubChem CID 175806112) has the molecular formula C22H19F12NO3 and a molecular weight of 573.37 g/mol. Its IUPAC name is 1-(trifluoromethoxy)-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine.
| Compound Name | 1-(trifluoromethoxy)-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 175806112 |
| Molecular Formula | C22H19F12NO3 |
| Molecular Weight | 573.37 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | 1-(trifluoromethoxy)-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine |
| SMILES | FC(F)(F)Oc1cccc(CCc2ccccc2OCCCC(OC(F)(F)F)N(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F12NO3/c23-19(24,25)35(20(26,27)28)18(38-22(32,33)34)9-4-12-36-17-8-2-1-6-15(17)11-10-14-5-3-7-16(13-14)37-21(29,30)31/h1-3,5-8,13,18H,4,9-12H2 |
| InChIKey | AZNOKUIESDQEHR-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.37 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|