C22H24F7NO3 — CID 175806128
1-(fluoromethoxy)-N-methyl-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N-(trifluoromethyl)butan-1-amine (PubChem CID 175806128) has the molecular formula C22H24F7NO3 and a molecular weight of 483.42 g/mol. Its IUPAC name is 1-(fluoromethoxy)-N-methyl-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N-(trifluoromethyl)butan-1-amine.
| Compound Name | 1-(fluoromethoxy)-N-methyl-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N-(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 175806128 |
| Molecular Formula | C22H24F7NO3 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 1-(fluoromethoxy)-N-methyl-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N-(trifluoromethyl)butan-1-amine |
| SMILES | CN(C(CCCOc1ccccc1CCc1cccc(OC(F)(F)F)c1)OCF)C(F)(F)F |
| InChI | InChI=1S/C22H24F7NO3/c1-30(21(24,25)26)20(32-15-23)10-5-13-31-19-9-3-2-7-17(19)12-11-16-6-4-8-18(14-16)33-22(27,28)29/h2-4,6-9,14,20H,5,10-13,15H2,1H3 |
| InChIKey | GWCBSLFZMHWVLL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|