C22H22F9NO3 — CID 135372687
(4R)-4-methoxy-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine (PubChem CID 135372687) has the molecular formula C22H22F9NO3 and a molecular weight of 519.40 g/mol. Its IUPAC name is (4R)-4-methoxy-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine.
| Compound Name | (4R)-4-methoxy-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 135372687 |
| Molecular Formula | C22H22F9NO3 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (4R)-4-methoxy-4-[2-[2-[3-(trifluoromethoxy)phenyl]ethyl]phenoxy]-N,N-bis(trifluoromethyl)butan-1-amine |
| SMILES | CO[C@@H](CCCN(C(F)(F)F)C(F)(F)F)Oc1ccccc1CCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F9NO3/c1-33-19(10-5-13-32(20(23,24)25)21(26,27)28)34-18-9-3-2-7-16(18)12-11-15-6-4-8-17(14-15)35-22(29,30)31/h2-4,6-9,14,19H,5,10-13H2,1H3/t19-/m1/s1 |
| InChIKey | CVRXCNOWGMAFME-LJQANCHMSA-N |
| XLogP | 6.84 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|