C24H35FNO6P — CID 153457167
(2R)-2-[[fluoro(propan-2-yloxy)phosphoryl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 153457167) has the molecular formula C24H35FNO6P and a molecular weight of 483.52 g/mol. Its IUPAC name is (2R)-2-[[fluoro(propan-2-yloxy)phosphoryl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | (2R)-2-[[fluoro(propan-2-yloxy)phosphoryl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 153457167 |
| Molecular Formula | C24H35FNO6P |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (2R)-2-[[fluoro(propan-2-yloxy)phosphoryl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1cccc(CCc2ccccc2OC[C@@H](CN(C)C)OCO[P@@](=O)(F)OC(C)C)c1 |
| InChI | InChI=1S/C24H35FNO6P/c1-19(2)32-33(25,27)31-18-30-23(16-26(3)4)17-29-24-12-7-6-10-21(24)14-13-20-9-8-11-22(15-20)28-5/h6-12,15,19,23H,13-14,16-18H2,1-5H3/t23-,33+/m1/s1 |
| InChIKey | RWSRFUZPDVINMS-NHRFMIRVSA-N |
| XLogP | 5.28 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|