C27H33N2O8PS — CID 154625787
(2R)-2-[[hydroxy-(4-nitrophenoxy)phosphinothioyl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 154625787) has the molecular formula C27H33N2O8PS and a molecular weight of 576.61 g/mol. Its IUPAC name is (2R)-2-[[hydroxy-(4-nitrophenoxy)phosphinothioyl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | (2R)-2-[[hydroxy-(4-nitrophenoxy)phosphinothioyl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 154625787 |
| Molecular Formula | C27H33N2O8PS |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | (2R)-2-[[hydroxy-(4-nitrophenoxy)phosphinothioyl]oxymethoxy]-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1cccc(CCc2ccccc2OC[C@@H](CN(C)C)OCOP(O)(=S)Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C27H33N2O8PS/c1-28(2)18-26(35-20-36-38(32,39)37-24-15-13-23(14-16-24)29(30)31)19-34-27-10-5-4-8-22(27)12-11-21-7-6-9-25(17-21)33-3/h4-10,13-17,26H,11-12,18-20H2,1-3H3,(H,32,39)/t26-,38?/m1/s1 |
| InChIKey | QEDFUIAPWDKGIV-MJZSQRDVSA-N |
| XLogP | 4.98 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|