C37H34Cl8NO7P — CID 156904845
bis[(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl phosphate (PubChem CID 156904845) has the molecular formula C37H34Cl8NO7P and a molecular weight of 919.28 g/mol. Its IUPAC name is bis[(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl phosphate.
| Compound Name | bis[(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl phosphate |
|---|---|
| PubChem CID | 156904845 |
| Molecular Formula | C37H34Cl8NO7P |
| Molecular Weight | 919.28 g/mol |
| Exact Mass | 914.96 |
| IUPAC Name | bis[(E)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl phosphate |
| SMILES | COc1cccc(CCc2ccccc2OC[C@@H](CN(C)C)OCOP(=O)(O/C(=C/Cl)c2cc(Cl)c(Cl)cc2Cl)O/C(=C/Cl)c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C37H34Cl8NO7P/c1-46(2)20-26(21-49-35-10-5-4-8-24(35)12-11-23-7-6-9-25(13-23)48-3)50-22-51-54(47,52-36(18-38)27-14-31(42)33(44)16-29(27)40)53-37(19-39)28-15-32(43)34(45)17-30(28)41/h4-10,13-19,26H,11-12,20-22H2,1-3H3/b36-18+,37-19+/t26-/m1/s1 |
| InChIKey | TWRIVUFLWUQAPZ-DWQZKEHLSA-N |
| XLogP | 13.32 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.28 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|