C29H32Cl4NO7P — CID 154625801
[2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl hydrogen phosphate (PubChem CID 154625801) has the molecular formula C29H32Cl4NO7P and a molecular weight of 679.36 g/mol. Its IUPAC name is [2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl hydrogen phosphate.
| Compound Name | [2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl hydrogen phosphate |
|---|---|
| PubChem CID | 154625801 |
| Molecular Formula | C29H32Cl4NO7P |
| Molecular Weight | 679.36 g/mol |
| Exact Mass | 677.07 |
| IUPAC Name | [2-chloro-1-(2,4,5-trichlorophenyl)ethenyl] [(2R)-1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxymethyl hydrogen phosphate |
| SMILES | COc1cccc(CCc2ccccc2OC[C@@H](CN(C)C)OCOP(=O)(O)OC(=CCl)c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C29H32Cl4NO7P/c1-34(2)17-23(18-38-28-10-5-4-8-21(28)12-11-20-7-6-9-22(13-20)37-3)39-19-40-42(35,36)41-29(16-30)24-14-26(32)27(33)15-25(24)31/h4-10,13-16,23H,11-12,17-19H2,1-3H3,(H,35,36)/t23-/m1/s1 |
| InChIKey | MXWMSHQCNMRBPC-HSZRJFAPSA-N |
| XLogP | 8.09 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.36 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|