C16H23NO — CID 134296434
2,5,7-tri(propan-2-yl)furo[3,2-b]pyridine (PubChem CID 134296434) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,5,7-tri(propan-2-yl)furo[3,2-b]pyridine.
| Compound Name | 2,5,7-tri(propan-2-yl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 134296434 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2,5,7-tri(propan-2-yl)furo[3,2-b]pyridine |
| SMILES | CC(C)c1cc(C(C)C)c2oc(C(C)C)cc2n1 |
| InChI | InChI=1S/C16H23NO/c1-9(2)12-7-13(10(3)4)17-14-8-15(11(5)6)18-16(12)14/h7-11H,1-6H3 |
| InChIKey | QLZFJJWTQAPXHH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |