C19H20F2O3 — CID 134300002
4-(2,2-difluoro-6-phenylmethoxycyclohexyl)oxyphenol (PubChem CID 134300002) has the molecular formula C19H20F2O3 and a molecular weight of 334.36 g/mol. Its IUPAC name is 4-(2,2-difluoro-6-phenylmethoxycyclohexyl)oxyphenol.
| Compound Name | 4-(2,2-difluoro-6-phenylmethoxycyclohexyl)oxyphenol |
|---|---|
| PubChem CID | 134300002 |
| Molecular Formula | C19H20F2O3 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-(2,2-difluoro-6-phenylmethoxycyclohexyl)oxyphenol |
| SMILES | Oc1ccc(OC2C(OCc3ccccc3)CCCC2(F)F)cc1 |
| InChI | InChI=1S/C19H20F2O3/c20-19(21)12-4-7-17(23-13-14-5-2-1-3-6-14)18(19)24-16-10-8-15(22)9-11-16/h1-3,5-6,8-11,17-18,22H,4,7,12-13H2 |
| InChIKey | BRJYYRAPFFADOT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |