C9H17NO5 — CID 134300874
2-[(1-hydroxy-2-methylpropyl)amino]pentanedioic acid (PubChem CID 134300874) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[(1-hydroxy-2-methylpropyl)amino]pentanedioic acid.
| Compound Name | 2-[(1-hydroxy-2-methylpropyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 134300874 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-[(1-hydroxy-2-methylpropyl)amino]pentanedioic acid |
| SMILES | CC(C)C(O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H17NO5/c1-5(2)8(13)10-6(9(14)15)3-4-7(11)12/h5-6,8,10,13H,3-4H2,1-2H3,(H,11,12)(H,14,15) |
| InChIKey | LTILRFQCZYSENP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|