C27H30ClN7O3S — CID 134302603
2-[3-(aminomethyl)phenyl]-N-[5-[4-[6-[[2-(3-chlorophenyl)-1,2-dihydroxyethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 134302603) has the molecular formula C27H30ClN7O3S and a molecular weight of 568.10 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]-N-[5-[4-[6-[[2-(3-chlorophenyl)-1,2-dihydroxyethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[3-(aminomethyl)phenyl]-N-[5-[4-[6-[[2-(3-chlorophenyl)-1,2-dihydroxyethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 134302603 |
| Molecular Formula | C27H30ClN7O3S |
| Molecular Weight | 568.10 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]-N-[5-[4-[6-[[2-(3-chlorophenyl)-1,2-dihydroxyethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | NCc1cccc(CC(=O)Nc2nnc(CCCCc3ccc(NC(O)C(O)c4cccc(Cl)c4)nn3)s2)c1 |
| InChI | InChI=1S/C27H30ClN7O3S/c28-20-8-4-7-19(15-20)25(37)26(38)30-22-12-11-21(32-33-22)9-1-2-10-24-34-35-27(39-24)31-23(36)14-17-5-3-6-18(13-17)16-29/h3-8,11-13,15,25-26,37-38H,1-2,9-10,14,16,29H2,(H,30,33)(H,31,35,36) |
| InChIKey | AJSHWOMQYCXFPS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 159.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.10 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|