C31H36FN7O4S — CID 123235707
2-fluoroethyl N-[[3-[2-[[6-[4-[5-[(1-hydroxy-2-phenylpropyl)amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate (PubChem CID 123235707) has the molecular formula C31H36FN7O4S and a molecular weight of 621.74 g/mol. Its IUPAC name is 2-fluoroethyl N-[[3-[2-[[6-[4-[5-[(1-hydroxy-2-phenylpropyl)amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate.
| Compound Name | 2-fluoroethyl N-[[3-[2-[[6-[4-[5-[(1-hydroxy-2-phenylpropyl)amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 123235707 |
| Molecular Formula | C31H36FN7O4S |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | 2-fluoroethyl N-[[3-[2-[[6-[4-[5-[(1-hydroxy-2-phenylpropyl)amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate |
| SMILES | CC(c1ccccc1)C(O)Nc1nnc(CCCCc2ccc(NC(=O)Cc3cccc(CNC(=O)OCCF)c3)nn2)s1 |
| InChI | InChI=1S/C31H36FN7O4S/c1-21(24-10-3-2-4-11-24)29(41)35-30-39-38-28(44-30)13-6-5-12-25-14-15-26(37-36-25)34-27(40)19-22-8-7-9-23(18-22)20-33-31(42)43-17-16-32/h2-4,7-11,14-15,18,21,29,41H,5-6,12-13,16-17,19-20H2,1H3,(H,33,42)(H,35,39)(H,34,37,40) |
| InChIKey | WVMIDNNPWQODDF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 151.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|