C30H35N7O3S — CID 144921978
N-[[3-[2-[[5-[4-(6-acetamidopyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]amino]-2-methoxyethyl]phenyl]methyl]-2-phenylacetamide (PubChem CID 144921978) has the molecular formula C30H35N7O3S and a molecular weight of 573.72 g/mol. Its IUPAC name is N-[[3-[2-[[5-[4-(6-acetamidopyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]amino]-2-methoxyethyl]phenyl]methyl]-2-phenylacetamide.
| Compound Name | N-[[3-[2-[[5-[4-(6-acetamidopyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]amino]-2-methoxyethyl]phenyl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 144921978 |
| Molecular Formula | C30H35N7O3S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | N-[[3-[2-[[5-[4-(6-acetamidopyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]amino]-2-methoxyethyl]phenyl]methyl]-2-phenylacetamide |
| SMILES | COC(Cc1cccc(CNC(=O)Cc2ccccc2)c1)Nc1nnc(CCCCc2ccc(NC(C)=O)nn2)s1 |
| InChI | InChI=1S/C30H35N7O3S/c1-21(38)32-26-16-15-25(34-35-26)13-6-7-14-29-36-37-30(41-29)33-28(40-2)19-23-11-8-12-24(17-23)20-31-27(39)18-22-9-4-3-5-10-22/h3-5,8-12,15-17,28H,6-7,13-14,18-20H2,1-2H3,(H,31,39)(H,33,37)(H,32,35,38) |
| InChIKey | MXADONAPMROYDH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 131.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|