C21H29FN4O2S — CID 134310640
2-[(1E,3E,5E,7E)-8-(5-fluoro-2H-triazol-4-yl)-3,7-dimethylocta-1,3,5,7-tetraenyl]-N,3,3-trimethylcyclohexene-1-sulfonamide (PubChem CID 134310640) has the molecular formula C21H29FN4O2S and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-8-(5-fluoro-2H-triazol-4-yl)-3,7-dimethylocta-1,3,5,7-tetraenyl]-N,3,3-trimethylcyclohexene-1-sulfonamide.
| Compound Name | 2-[(1E,3E,5E,7E)-8-(5-fluoro-2H-triazol-4-yl)-3,7-dimethylocta-1,3,5,7-tetraenyl]-N,3,3-trimethylcyclohexene-1-sulfonamide |
|---|---|
| PubChem CID | 134310640 |
| Molecular Formula | C21H29FN4O2S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-8-(5-fluoro-2H-triazol-4-yl)-3,7-dimethylocta-1,3,5,7-tetraenyl]-N,3,3-trimethylcyclohexene-1-sulfonamide |
| SMILES | CNS(=O)(=O)C1=C(/C=C/C(C)=C/C=C/C(C)=C/c2n[nH]nc2F)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H29FN4O2S/c1-15(8-6-9-16(2)14-18-20(22)25-26-24-18)11-12-17-19(29(27,28)23-5)10-7-13-21(17,3)4/h6,8-9,11-12,14,23H,7,10,13H2,1-5H3,(H,24,25,26)/b9-6+,12-11+,15-8+,16-14+ |
| InChIKey | BENHGEDGAZUFOI-YCNIQYBTSA-N |
| XLogP | 4.42 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|