C20H28N4 — CID 6439750
5-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-2H-tetrazole (PubChem CID 6439750) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 5-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-2H-tetrazole.
| Compound Name | 5-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 6439750 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 5-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-2H-tetrazole |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/c2nn[nH]n2)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H28N4/c1-15(8-6-9-16(2)14-19-21-23-24-22-19)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22,23,24)/b9-6+,12-11+,15-8+,16-14+ |
| InChIKey | XXCOKGZUOMUVEP-YCNIQYBTSA-N |
| XLogP | 5.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|