C24H31N3O3 — CID 158319483
5-[(1E,3E,5E,7E)-8-(6,6-dimethyl-2-propanoylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-2H-triazole-4-carboxylic acid (PubChem CID 158319483) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 5-[(1E,3E,5E,7E)-8-(6,6-dimethyl-2-propanoylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-2H-triazole-4-carboxylic acid.
| Compound Name | 5-[(1E,3E,5E,7E)-8-(6,6-dimethyl-2-propanoylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 158319483 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 5-[(1E,3E,5E,7E)-8-(6,6-dimethyl-2-propanoylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-2H-triazole-4-carboxylic acid |
| SMILES | CCC(=O)C1=C(/C=C/C(C)=C/C=C/C(C)=C/c2n[nH]nc2C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H31N3O3/c1-6-21(28)18-11-8-14-24(4,5)19(18)13-12-16(2)9-7-10-17(3)15-20-22(23(29)30)26-27-25-20/h7,9-10,12-13,15H,6,8,11,14H2,1-5H3,(H,29,30)(H,25,26,27)/b10-7+,13-12+,16-9+,17-15+ |
| InChIKey | RGRGNVAVIHILPT-DXYSAURFSA-N |
| XLogP | 5.45 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|