C23H32N4O — CID 134310638
2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-N,N,3,3-tetramethylcyclohexene-1-carboxamide (PubChem CID 134310638) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-N,N,3,3-tetramethylcyclohexene-1-carboxamide.
| Compound Name | 2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-N,N,3,3-tetramethylcyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 134310638 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-N,N,3,3-tetramethylcyclohexene-1-carboxamide |
| SMILES | CC(/C=C/C1=C(C(=O)N(C)C)CCCC1(C)C)=C\C=C\C(C)=C\c1ncn[nH]1 |
| InChI | InChI=1S/C23H32N4O/c1-17(9-7-10-18(2)15-21-24-16-25-26-21)12-13-20-19(22(28)27(5)6)11-8-14-23(20,3)4/h7,9-10,12-13,15-16H,8,11,14H2,1-6H3,(H,24,25,26)/b10-7+,13-12+,17-9+,18-15+ |
| InChIKey | DDVHFTRNHHATHP-XNJDZTGNSA-N |
| XLogP | 4.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|