C21H31N3 — CID 134315194
5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]-1H-1,2,4-triazole (PubChem CID 134315194) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is 5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 134315194 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]-1H-1,2,4-triazole |
| SMILES | CC1=C(CC/C(C)=C/C=C/C(C)=C/c2ncn[nH]2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H31N3/c1-16(8-6-9-17(2)14-20-22-15-23-24-20)11-12-19-18(3)10-7-13-21(19,4)5/h6,8-9,14-15H,7,10-13H2,1-5H3,(H,22,23,24)/b9-6+,16-8+,17-14+ |
| InChIKey | ZQVHPLWQYDCPKC-AHUZCCJVSA-N |
| XLogP | 6.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|