C22H30N2O2 — CID 134315167
5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]imidazole-2,4-dione (PubChem CID 134315167) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]imidazole-2,4-dione.
| Compound Name | 5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]imidazole-2,4-dione |
|---|---|
| PubChem CID | 134315167 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 5-[(1E,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5-trienyl]imidazole-2,4-dione |
| SMILES | CC1=C(CC/C(C)=C/C=C/C(C)=C/C2=NC(=O)NC2=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H30N2O2/c1-15(11-12-18-17(3)10-7-13-22(18,4)5)8-6-9-16(2)14-19-20(25)24-21(26)23-19/h6,8-9,14H,7,10-13H2,1-5H3,(H,24,25,26)/b9-6+,15-8+,16-14+ |
| InChIKey | PAVVBDUKIBXEJA-SNQZJYSLSA-N |
| XLogP | 5.43 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|