C47H24F6N2O4 — CID 13431774
5-[2-[1,3-dioxo-2-[3-(2-phenylethynyl)phenyl]isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-(2-phenylethynyl)phenyl]isoindole-1,3-dione (PubChem CID 13431774) has the molecular formula C47H24F6N2O4 and a molecular weight of 794.71 g/mol. Its IUPAC name is 5-[2-[1,3-dioxo-2-[3-(2-phenylethynyl)phenyl]isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-(2-phenylethynyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-[1,3-dioxo-2-[3-(2-phenylethynyl)phenyl]isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-(2-phenylethynyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 13431774 |
| Molecular Formula | C47H24F6N2O4 |
| Molecular Weight | 794.71 g/mol |
| Exact Mass | 794.16 |
| IUPAC Name | 5-[2-[1,3-dioxo-2-[3-(2-phenylethynyl)phenyl]isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-(2-phenylethynyl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(C(c3ccc4c(c3)C(=O)N(c3cccc(C#Cc5ccccc5)c3)C4=O)(C(F)(F)F)C(F)(F)F)cc2C(=O)N1c1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C47H24F6N2O4/c48-46(49,50)45(47(51,52)53,33-21-23-37-39(27-33)43(58)54(41(37)56)35-15-7-13-31(25-35)19-17-29-9-3-1-4-10-29)34-22-24-38-40(28-34)44(59)55(42(38)57)36-16-8-14-32(26-36)20-18-30-11-5-2-6-12-30/h1-16,21-28H |
| InChIKey | XGNLDFLDLZJPHZ-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.71 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|