C51H42N2 — CID 134320769
N-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-3-phenyl-4-(1-phenylindol-4-yl)-N-(4-phenylphenyl)aniline (PubChem CID 134320769) has the molecular formula C51H42N2 and a molecular weight of 682.91 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-3-phenyl-4-(1-phenylindol-4-yl)-N-(4-phenylphenyl)aniline.
| Compound Name | N-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-3-phenyl-4-(1-phenylindol-4-yl)-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 134320769 |
| Molecular Formula | C51H42N2 |
| Molecular Weight | 682.91 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | N-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-3-phenyl-4-(1-phenylindol-4-yl)-N-(4-phenylphenyl)aniline |
| SMILES | C/C=C(\C=C/CC)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3cccc4c3ccn4-c3ccccc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C51H42N2/c1-3-5-16-38(4-2)40-25-29-44(30-26-40)53(45-31-27-41(28-32-45)39-17-9-6-10-18-39)46-33-34-48(50(37-46)42-19-11-7-12-20-42)47-23-15-24-51-49(47)35-36-52(51)43-21-13-8-14-22-43/h4-37H,3H2,1-2H3/b16-5-,38-4+ |
| InChIKey | HREZAIOHUZWNGA-UAMVCMPMSA-N |
| XLogP | 14.47 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.91 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|