C23H43ClN6O2 — CID 134321481
3,3-diamino-2-(6-chloro-4-azatricyclo[6.2.1.01,8]undecan-3-yl)-N-[4-[3-(dimethylamino)propoxy]piperidin-3-yl]propanamide (PubChem CID 134321481) has the molecular formula C23H43ClN6O2 and a molecular weight of 471.09 g/mol. Its IUPAC name is 3,3-diamino-2-(6-chloro-4-azatricyclo[6.2.1.01,8]undecan-3-yl)-N-[4-[3-(dimethylamino)propoxy]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(6-chloro-4-azatricyclo[6.2.1.01,8]undecan-3-yl)-N-[4-[3-(dimethylamino)propoxy]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 134321481 |
| Molecular Formula | C23H43ClN6O2 |
| Molecular Weight | 471.09 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 3,3-diamino-2-(6-chloro-4-azatricyclo[6.2.1.01,8]undecan-3-yl)-N-[4-[3-(dimethylamino)propoxy]piperidin-3-yl]propanamide |
| SMILES | CN(C)CCCOC1CCNCC1NC(=O)C(C(N)N)C1CC23CCC2(CC(Cl)CN1)C3 |
| InChI | InChI=1S/C23H43ClN6O2/c1-30(2)8-3-9-32-18-4-7-27-13-17(18)29-21(31)19(20(25)26)16-11-23-6-5-22(23,14-23)10-15(24)12-28-16/h15-20,27-28H,3-14,25-26H2,1-2H3,(H,29,31) |
| InChIKey | KHHBNGLOXLICMD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.09 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|