C24H43ClN6O2 — CID 123620857
3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1,4-diethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl]propanamide (PubChem CID 123620857) has the molecular formula C24H43ClN6O2 and a molecular weight of 483.10 g/mol. Its IUPAC name is 3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1,4-diethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl]propanamide.
| Compound Name | 3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1,4-diethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl]propanamide |
|---|---|
| PubChem CID | 123620857 |
| Molecular Formula | C24H43ClN6O2 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1,4-diethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl]propanamide |
| SMILES | CCN1CC(CC#N)CC2(C)CC2(CC)CC1C(C(=O)NC1CNC(Cl)CC1OC)C(N)N |
| InChI | InChI=1S/C24H43ClN6O2/c1-5-24-11-17(31(6-2)13-15(7-8-26)10-23(24,3)14-24)20(21(27)28)22(32)30-16-12-29-19(25)9-18(16)33-4/h15-21,29H,5-7,9-14,27-28H2,1-4H3,(H,30,32) |
| InChIKey | ZBDACPVXBLIXSN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|