C23H27ClN4O4S — CID 134331414
(6S)-6-[(2R)-but-3-en-2-yl]-1-(3-carbamoyl-5-chlorophenyl)sulfonyl-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide (PubChem CID 134331414) has the molecular formula C23H27ClN4O4S and a molecular weight of 491.01 g/mol. Its IUPAC name is (6S)-6-[(2R)-but-3-en-2-yl]-1-(3-carbamoyl-5-chlorophenyl)sulfonyl-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide.
| Compound Name | (6S)-6-[(2R)-but-3-en-2-yl]-1-(3-carbamoyl-5-chlorophenyl)sulfonyl-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 134331414 |
| Molecular Formula | C23H27ClN4O4S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | (6S)-6-[(2R)-but-3-en-2-yl]-1-(3-carbamoyl-5-chlorophenyl)sulfonyl-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide |
| SMILES | C=C[C@@H](C)[C@@H]1CCCC(C(=O)NCc2ccccn2)N1S(=O)(=O)c1cc(Cl)cc(C(N)=O)c1 |
| InChI | InChI=1S/C23H27ClN4O4S/c1-3-15(2)20-8-6-9-21(23(30)27-14-18-7-4-5-10-26-18)28(20)33(31,32)19-12-16(22(25)29)11-17(24)13-19/h3-5,7,10-13,15,20-21H,1,6,8-9,14H2,2H3,(H2,25,29)(H,27,30)/t15-,20+,21?/m1/s1 |
| InChIKey | KUYATBKIRVCJGG-GZOQVGHDSA-N |
| XLogP | 2.88 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|