C24H29N3O4S — CID 134331440
(6S)-6-[(2R)-but-3-en-2-yl]-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide (PubChem CID 134331440) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is (6S)-6-[(2R)-but-3-en-2-yl]-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide.
| Compound Name | (6S)-6-[(2R)-but-3-en-2-yl]-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 134331440 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (6S)-6-[(2R)-but-3-en-2-yl]-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-N-(pyridin-2-ylmethyl)piperidine-2-carboxamide |
| SMILES | C=C[C@@H](C)[C@@H]1CCCC(C(=O)NCc2ccccn2)N1S(=O)(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C24H29N3O4S/c1-3-17(2)21-8-6-9-22(24(28)26-16-19-7-4-5-13-25-19)27(21)32(29,30)20-10-11-23-18(15-20)12-14-31-23/h3-5,7,10-11,13,15,17,21-22H,1,6,8-9,12,14,16H2,2H3,(H,26,28)/t17-,21+,22?/m1/s1 |
| InChIKey | POYVHVLEOUTBBD-HWWMDGIVSA-N |
| XLogP | 3.07 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|