C19H38N2O2 — CID 134332061
2-(tert-butylamino)-N-(2-oxooctan-3-yl)heptanamide (PubChem CID 134332061) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-(2-oxooctan-3-yl)heptanamide.
| Compound Name | 2-(tert-butylamino)-N-(2-oxooctan-3-yl)heptanamide |
|---|---|
| PubChem CID | 134332061 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | 2-(tert-butylamino)-N-(2-oxooctan-3-yl)heptanamide |
| SMILES | CCCCCC(NC(=O)C(CCCCC)NC(C)(C)C)C(C)=O |
| InChI | InChI=1S/C19H38N2O2/c1-7-9-11-13-16(15(3)22)20-18(23)17(14-12-10-8-2)21-19(4,5)6/h16-17,21H,7-14H2,1-6H3,(H,20,23) |
| InChIKey | GMMUNRRRGIRBBT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|