C22H43N5O4 — CID 91405705
2-[[2-[(4-amino-2-methylbutanoyl)amino]acetyl]amino]-N-(1-amino-4-oxopentan-3-yl)decanamide (PubChem CID 91405705) has the molecular formula C22H43N5O4 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[[2-[(4-amino-2-methylbutanoyl)amino]acetyl]amino]-N-(1-amino-4-oxopentan-3-yl)decanamide.
| Compound Name | 2-[[2-[(4-amino-2-methylbutanoyl)amino]acetyl]amino]-N-(1-amino-4-oxopentan-3-yl)decanamide |
|---|---|
| PubChem CID | 91405705 |
| Molecular Formula | C22H43N5O4 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.33 |
| IUPAC Name | 2-[[2-[(4-amino-2-methylbutanoyl)amino]acetyl]amino]-N-(1-amino-4-oxopentan-3-yl)decanamide |
| SMILES | CCCCCCCCC(NC(=O)CNC(=O)C(C)CCN)C(=O)NC(CCN)C(C)=O |
| InChI | InChI=1S/C22H43N5O4/c1-4-5-6-7-8-9-10-19(22(31)27-18(12-14-24)17(3)28)26-20(29)15-25-21(30)16(2)11-13-23/h16,18-19H,4-15,23-24H2,1-3H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | XJKCBAMHLIQSBR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|