C16H32N4O3 — CID 167133850
3-amino-N-[2-[(1-amino-4-oxohexan-3-yl)amino]-2-oxoethyl]octanamide (PubChem CID 167133850) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-amino-N-[2-[(1-amino-4-oxohexan-3-yl)amino]-2-oxoethyl]octanamide.
| Compound Name | 3-amino-N-[2-[(1-amino-4-oxohexan-3-yl)amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 167133850 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 3-amino-N-[2-[(1-amino-4-oxohexan-3-yl)amino]-2-oxoethyl]octanamide |
| SMILES | CCCCCC(N)CC(=O)NCC(=O)NC(CCN)C(=O)CC |
| InChI | InChI=1S/C16H32N4O3/c1-3-5-6-7-12(18)10-15(22)19-11-16(23)20-13(8-9-17)14(21)4-2/h12-13H,3-11,17-18H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | WZFWDWWXTKXARS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|