C15H19N3O2S — CID 134333080
N-(3,4-dimethoxyphenyl)-2-imidazol-1-yl-2-methylpropanethioamide (PubChem CID 134333080) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-imidazol-1-yl-2-methylpropanethioamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-imidazol-1-yl-2-methylpropanethioamide |
|---|---|
| PubChem CID | 134333080 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-imidazol-1-yl-2-methylpropanethioamide |
| SMILES | COc1ccc(NC(=S)C(C)(C)n2ccnc2)cc1OC |
| InChI | InChI=1S/C15H19N3O2S/c1-15(2,18-8-7-16-10-18)14(21)17-11-5-6-12(19-3)13(9-11)20-4/h5-10H,1-4H3,(H,17,21) |
| InChIKey | NEMHKHMAWFDFKC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|