C11H24N2 — CID 134334582
N'-pent-1-en-2-ylhexane-1,6-diamine (PubChem CID 134334582) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N'-pent-1-en-2-ylhexane-1,6-diamine.
| Compound Name | N'-pent-1-en-2-ylhexane-1,6-diamine |
|---|---|
| PubChem CID | 134334582 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N'-pent-1-en-2-ylhexane-1,6-diamine |
| SMILES | C=C(CCC)NCCCCCCN |
| InChI | InChI=1S/C11H24N2/c1-3-8-11(2)13-10-7-5-4-6-9-12/h13H,2-10,12H2,1H3 |
| InChIKey | IPOBRBKOCJSRHQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|