C31H45N3O2 — CID 134343693
2-(dimethylamino)-1-[4-[2-[(3E,5E,7R)-6-methoxy-7-methylnona-1,3,5-trien-4-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone (PubChem CID 134343693) has the molecular formula C31H45N3O2 and a molecular weight of 491.72 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[4-[2-[(3E,5E,7R)-6-methoxy-7-methylnona-1,3,5-trien-4-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(dimethylamino)-1-[4-[2-[(3E,5E,7R)-6-methoxy-7-methylnona-1,3,5-trien-4-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 134343693 |
| Molecular Formula | C31H45N3O2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | 2-(dimethylamino)-1-[4-[2-[(3E,5E,7R)-6-methoxy-7-methylnona-1,3,5-trien-4-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone |
| SMILES | C=C/C=C(\C=C(\OC)[C@H](C)CC)c1[nH]c2ccc(C3CCN(C(=O)CN(C)C)CC3)cc2c1C(C)C |
| InChI | InChI=1S/C31H45N3O2/c1-9-11-25(19-28(36-8)22(5)10-2)31-30(21(3)4)26-18-24(12-13-27(26)32-31)23-14-16-34(17-15-23)29(35)20-33(6)7/h9,11-13,18-19,21-23,32H,1,10,14-17,20H2,2-8H3/b25-11+,28-19+/t22-/m1/s1 |
| InChIKey | FKCQQHCDTAGMQY-ONAWYZOHSA-N |
| XLogP | 6.70 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|