C33H49N3O — CID 142302384
N,N-dimethyl-2-[4-[3-propan-2-yl-2-[(3E,5Z)-2,3,6,7-tetramethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]acetamide (PubChem CID 142302384) has the molecular formula C33H49N3O and a molecular weight of 503.78 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[3-propan-2-yl-2-[(3E,5Z)-2,3,6,7-tetramethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-[3-propan-2-yl-2-[(3E,5Z)-2,3,6,7-tetramethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 142302384 |
| Molecular Formula | C33H49N3O |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 503.39 |
| IUPAC Name | N,N-dimethyl-2-[4-[3-propan-2-yl-2-[(3E,5Z)-2,3,6,7-tetramethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]acetamide |
| SMILES | C=C(C)/C(C)=C(\C=C(\C)C(C)CC)c1[nH]c2ccc(C3CCN(CC(=O)N(C)C)CC3)cc2c1C(C)C |
| InChI | InChI=1S/C33H49N3O/c1-11-23(6)24(7)18-28(25(8)21(2)3)33-32(22(4)5)29-19-27(12-13-30(29)34-33)26-14-16-36(17-15-26)20-31(37)35(9)10/h12-13,18-19,22-23,26,34H,2,11,14-17,20H2,1,3-10H3/b24-18-,28-25+ |
| InChIKey | RQAIXZDEKOAMHO-RKIOSWPMSA-N |
| XLogP | 7.90 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|