C35H51N3 — CID 142302471
acetylene;(Z)-N-methyl-1-[4-[3-propan-2-yl-2-[(3E,5Z)-3,6,7-trimethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]but-2-en-2-amine (PubChem CID 142302471) has the molecular formula C35H51N3 and a molecular weight of 513.81 g/mol. Its IUPAC name is acetylene;(Z)-N-methyl-1-[4-[3-propan-2-yl-2-[(3E,5Z)-3,6,7-trimethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]but-2-en-2-amine.
| Compound Name | acetylene;(Z)-N-methyl-1-[4-[3-propan-2-yl-2-[(3E,5Z)-3,6,7-trimethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]but-2-en-2-amine |
|---|---|
| PubChem CID | 142302471 |
| Molecular Formula | C35H51N3 |
| Molecular Weight | 513.81 g/mol |
| Exact Mass | 513.41 |
| IUPAC Name | acetylene;(Z)-N-methyl-1-[4-[3-propan-2-yl-2-[(3E,5Z)-3,6,7-trimethylnona-1,3,5-trien-4-yl]-1H-indol-5-yl]piperidin-1-yl]but-2-en-2-amine |
| SMILES | C#C.C=C/C(C)=C(\C=C(\C)C(C)CC)c1[nH]c2ccc(C3CCN(C/C(=C/C)NC)CC3)cc2c1C(C)C |
| InChI | InChI=1S/C33H49N3.C2H2/c1-10-23(6)25(8)19-29(24(7)11-2)33-32(22(4)5)30-20-27(13-14-31(30)35-33)26-15-17-36(18-16-26)21-28(12-3)34-9;1-2/h11-14,19-20,22-23,26,34-35H,2,10,15-18,21H2,1,3-9H3;1-2H/b25-19-,28-12-,29-24+; |
| InChIKey | FEWGCCLAGWZASP-CZVIPCKASA-N |
| XLogP | 8.80 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.81 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|