C33H48N4 — CID 145432316
N'-methyl-N-[(4Z,6E)-6-[5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide (PubChem CID 145432316) has the molecular formula C33H48N4 and a molecular weight of 500.78 g/mol. Its IUPAC name is N'-methyl-N-[(4Z,6E)-6-[5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide.
| Compound Name | N'-methyl-N-[(4Z,6E)-6-[5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide |
|---|---|
| PubChem CID | 145432316 |
| Molecular Formula | C33H48N4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | N'-methyl-N-[(4Z,6E)-6-[5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide |
| SMILES | C=C(CC(C)C)N1CCC(c2ccc3[nH]c(C(/C=C\C(CC)=N\C(C)=N\C)=C/C)c(C(C)C)c3c2)CC1 |
| InChI | InChI=1S/C33H48N4/c1-10-26(12-14-29(11-2)35-25(8)34-9)33-32(23(5)6)30-21-28(13-15-31(30)36-33)27-16-18-37(19-17-27)24(7)20-22(3)4/h10,12-15,21-23,27,36H,7,11,16-20H2,1-6,8-9H3/b14-12-,26-10+,34-25+,35-29+ |
| InChIKey | ISVWQXLXKLDEGL-LRYVSIEGSA-N |
| XLogP | 8.89 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|