C31H42F2N4O — CID 145431858
N-[(4Z,6E)-6-[3-(2,2-difluoroethyl)-5-[1-(4-hydroxy-4-methylpent-1-en-2-yl)piperidin-4-yl]-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide (PubChem CID 145431858) has the molecular formula C31H42F2N4O and a molecular weight of 524.70 g/mol. Its IUPAC name is N-[(4Z,6E)-6-[3-(2,2-difluoroethyl)-5-[1-(4-hydroxy-4-methylpent-1-en-2-yl)piperidin-4-yl]-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide.
| Compound Name | N-[(4Z,6E)-6-[3-(2,2-difluoroethyl)-5-[1-(4-hydroxy-4-methylpent-1-en-2-yl)piperidin-4-yl]-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide |
|---|---|
| PubChem CID | 145431858 |
| Molecular Formula | C31H42F2N4O |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | N-[(4Z,6E)-6-[3-(2,2-difluoroethyl)-5-[1-(4-hydroxy-4-methylpent-1-en-2-yl)piperidin-4-yl]-1H-indol-2-yl]octa-4,6-dien-3-ylidene]ethanimidamide |
| SMILES | [H]/N=C(C)/N=C(/C=C\C(=C/C)c1[nH]c2ccc(C3CCN(C(=C)CC(C)(C)O)CC3)cc2c1CC(F)F)CC |
| InChI | InChI=1S/C31H42F2N4O/c1-7-22(9-11-25(8-2)35-21(4)34)30-27(18-29(32)33)26-17-24(10-12-28(26)36-30)23-13-15-37(16-14-23)20(3)19-31(5,6)38/h7,9-12,17,23,29,34,36,38H,3,8,13-16,18-19H2,1-2,4-6H3/b11-9-,22-7+,34-21+,35-25+ |
| InChIKey | JGXGEYHQUQOSRU-SCBJSJGASA-N |
| XLogP | 7.64 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|