C27H38N2 — CID 142302612
2-[(3E,5Z)-6,7-dimethylnona-1,3,5-trien-4-yl]-3-ethyl-5-(1-methylpiperidin-4-yl)-1H-indole (PubChem CID 142302612) has the molecular formula C27H38N2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 2-[(3E,5Z)-6,7-dimethylnona-1,3,5-trien-4-yl]-3-ethyl-5-(1-methylpiperidin-4-yl)-1H-indole.
| Compound Name | 2-[(3E,5Z)-6,7-dimethylnona-1,3,5-trien-4-yl]-3-ethyl-5-(1-methylpiperidin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 142302612 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 2-[(3E,5Z)-6,7-dimethylnona-1,3,5-trien-4-yl]-3-ethyl-5-(1-methylpiperidin-4-yl)-1H-indole |
| SMILES | C=C/C=C(\C=C(\C)C(C)CC)c1[nH]c2ccc(C3CCN(C)CC3)cc2c1CC |
| InChI | InChI=1S/C27H38N2/c1-7-10-23(17-20(5)19(4)8-2)27-24(9-3)25-18-22(11-12-26(25)28-27)21-13-15-29(6)16-14-21/h7,10-12,17-19,21,28H,1,8-9,13-16H2,2-6H3/b20-17-,23-10+ |
| InChIKey | WYSKXFZCAJEFGQ-DZPQXGQJSA-N |
| XLogP | 7.10 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|