C28H38F2N2 — CID 142302336
acetylene;5-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[(4E)-2-methylhepta-2,4-dien-4-yl]-3-propan-2-yl-1H-indole (PubChem CID 142302336) has the molecular formula C28H38F2N2 and a molecular weight of 440.62 g/mol. Its IUPAC name is acetylene;5-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[(4E)-2-methylhepta-2,4-dien-4-yl]-3-propan-2-yl-1H-indole.
| Compound Name | acetylene;5-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[(4E)-2-methylhepta-2,4-dien-4-yl]-3-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 142302336 |
| Molecular Formula | C28H38F2N2 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | acetylene;5-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[(4E)-2-methylhepta-2,4-dien-4-yl]-3-propan-2-yl-1H-indole |
| SMILES | C#C.CC/C=C(\C=C(C)C)c1[nH]c2ccc(C3CCN(CC(F)F)CC3)cc2c1C(C)C |
| InChI | InChI=1S/C26H36F2N2.C2H2/c1-6-7-21(14-17(2)3)26-25(18(4)5)22-15-20(8-9-23(22)29-26)19-10-12-30(13-11-19)16-24(27)28;1-2/h7-9,14-15,18-19,24,29H,6,10-13,16H2,1-5H3;1-2H/b21-7+; |
| InChIKey | PRPYNJKZEWNEGM-RTXBPYFBSA-N |
| XLogP | 7.74 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|